Products 55784-21-9

CAS 55784-21-9 is the registry number for 5-(4-Ethoxyphenyl)-5-ethylbarbituric acid. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

5-(4-ethoxyphenyl)-5-ethyl-1,3-diazinane-2,4,6-trione (CAS 55784-21-9) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 5-(4-ethoxyphenyl)-5-ethyl-1,3-diazinane-2,4,6-trione. InChIKey: NIEZSPZJJAAUKU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O4
Molecular weight276.29 g/mol
IUPAC name5-(4-ethoxyphenyl)-5-ethyl-1,3-diazinane-2,4,6-trione
InChIKeyNIEZSPZJJAAUKU-UHFFFAOYSA-N
SMILESCCC1(C(=O)NC(=O)NC1=O)C2=CC=C(C=C2)OCC

Computed by PubChem (NCBI)