Products 56022-07-2
CAS 56022-07-2 appears in our catalog under these names: 2，4–Dichloro–6–methylnicotinic acid, 2,4-Dichloro-6-methylnicotinic acid, 2,4-Dichloro-6-methylnicotinic acid, ≥95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-6-methylpyridine-3-carboxylic acid (CAS 56022-07-2) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,4-dichloro-6-methylpyridine-3-carboxylic acid. InChIKey: CIVCELMLGDGMKZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyridine-3-carboxylic acid |
| InChIKey | CIVCELMLGDGMKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)