Products 562792-76-1
CAS 562792-76-1 is the registry number for 6-(3,4-Dimethoxy-phenyl)-imidazo[2,1-b]thiazole-5-carbaldehyde, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 562792-76-1) is a chemical compound with the molecular formula C14H12N2O3S and a molecular weight of 288.32 g/mol. IUPAC name: 6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: PMRNVQUGKAAULA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | PMRNVQUGKAAULA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(N3C=CSC3=N2)C=O)OC |
Computed by PubChem (NCBI)