Products 565170-66-3
CAS 565170-66-3 appears in our catalog under these names: (Acenaphthen-5-ylsulfanyl)-acetic acid, 95%, 2-(1,2-Dihydroacenaphthylen-5-ylsulfanyl)acetic acid, 95%, 2-(1,2-Dihydroacenaphthylen-5-ylsulfanyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid (CAS 565170-66-3) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid. InChIKey: ILIYQPKGPUGGBV-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid |
| InChIKey | ILIYQPKGPUGGBV-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)SCC(=O)O |
Computed by PubChem (NCBI)