Products 10490-07-0
CAS 10490-07-0 appears in our catalog under these names: Alpha-(phenylthio)phenylacetic acid, 95%, 2-Phenyl-2-(phenylthio)acetic acid, 95+%, ALPHA–(PHENYLTHIO)PHENYLACETIC ACID, 2-Phenyl-2-(phenylthio)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 100g, 5g, 2,5g, 0,25g.
2-phenyl-2-phenylsulfanylacetic acid (CAS 10490-07-0) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 2-phenyl-2-phenylsulfanylacetic acid. InChIKey: UOCQATUFLPHRNG-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-phenyl-2-phenylsulfanylacetic acid |
| InChIKey | UOCQATUFLPHRNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-phenyl-2-(phenylsulfanyl)acetic acid, 2-Phenyl-2-(phenylthio)acetic acid, ALPHA-(PHENYLTHIO)PHENYLACETIC ACID, 2-phenyl-2-phenylsulfanylacetic acid, 2-phenyl-2-phenylthioacetic acid, phenyl(phenylsulfanyl)acetic acid, (phenylthio)phenylacetic acid, phenylthio-phenyl acetic acid, alpha-phenylthio-phenylacetic acid, 2-Phenyl-2-(phenylthio)aceticacid