CAS 885965-43-5 appears in our catalog under these names: 3'-(Methylthio)biphenyl-3-carboxylic acid, 98%, 3'-(Methylthio)-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(3-methylsulfanylphenyl)benzoic acid (CAS 885965-43-5) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 3-(3-methylsulfanylphenyl)benzoic acid. InChIKey: YQYOLHQFXAEDTK-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 3-(3-methylsulfanylphenyl)benzoic acid |
| InChIKey | YQYOLHQFXAEDTK-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)