CAS 728918-92-1 appears in our catalog under these names: 4'-(Methylthio)biphenyl-3-carboxylic acid, 98%, 4'-(Methylthio)-(1,1'-biphenyl)-3-carboxylic acid, 98%, 4'-Methylsulfanyl-biphenyl-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
3-(4-methylsulfanylphenyl)benzoic acid (CAS 728918-92-1) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 3-(4-methylsulfanylphenyl)benzoic acid. InChIKey: BJBNXCLQJHPZDB-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 3-(4-methylsulfanylphenyl)benzoic acid |
| InChIKey | BJBNXCLQJHPZDB-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)