CAS 22855-95-4 appears in our catalog under these names: 4-(Benzylsulfanyl)benzoic acid, 98%, 4-(Benzylthio)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
4-benzylsulfanylbenzoic acid (CAS 22855-95-4) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 4-benzylsulfanylbenzoic acid. InChIKey: BIGZCUUCDAVUIJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 4-benzylsulfanylbenzoic acid |
| InChIKey | BIGZCUUCDAVUIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)