Products 1699-03-2
CAS 1699-03-2 appears in our catalog under these names: 2–Phenylthiomethylbenzoic Acid, 2-Phenylthiomethylbenzoic Acid, 2-Phenylthiomethylbenzoic acid, 95%, 2-((Phenylthio)methyl)benzoic acid, 2-((Phenylthio)methyl)benzoic acid, 95%. Offered by: GLPBio, TCI, Combi-blocks, Chemat, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 500mg, 50mg.
2-(phenylsulfanylmethyl)benzoic acid (CAS 1699-03-2) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 2-(phenylsulfanylmethyl)benzoic acid. InChIKey: QXPRAGVOCILNHG-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-(phenylsulfanylmethyl)benzoic acid |
| InChIKey | QXPRAGVOCILNHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-((Phenylthio)methyl)benzoic acid, 2-[(Phenylthio)methyl]benzoic acid, 2-Phenylthiomethylbenzoic Acid, 2-(phenylsulfanylmethyl)benzoic acid, 2-[(phenylsulfanyl)methyl]benzoic acid, 2-(phenylthiomethyl)benzoic acid, 2-[(phenylsulfanyl)methyl]benzenecarboxylic acid, o-phenylthiomethylbenzoic acid, 2-Phenylmercaptomethylbenzoic Acid, 2-((Phenylthio)methyl)benzoicacid