Products 186295-30-7

CAS 186295-30-7 is the registry number for 2-(2-Methylthiophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-methylsulfanylphenyl)benzoic acid (CAS 186295-30-7) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 2-(2-methylsulfanylphenyl)benzoic acid. InChIKey: WPNXPSYCZSXYTH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O2S
Molecular weight244.31 g/mol
IUPAC name2-(2-methylsulfanylphenyl)benzoic acid
InChIKeyWPNXPSYCZSXYTH-UHFFFAOYSA-N
SMILESCSC1=CC=CC=C1C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)