CAS 56518-46-8 is the registry number for 4-Chloro-3,5-dimethoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-3,5-dimethoxybenzoic acid (CAS 56518-46-8) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 4-chloro-3,5-dimethoxybenzoic acid. InChIKey: XHSQKGHTBAOEDV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 4-chloro-3,5-dimethoxybenzoic acid |
| InChIKey | XHSQKGHTBAOEDV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Cl)OC)C(=O)O |
Computed by PubChem (NCBI)