Products 569-02-8
CAS 569-02-8 appears in our catalog under these names: γ-Isofagarine, γ-Isofagarine, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 10 mg, 5 mg, 5mg.
8-methoxy-9-methylfuro[2,3-b]quinolin-4-one (CAS 569-02-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 8-methoxy-9-methylfuro[2,3-b]quinolin-4-one. InChIKey: VNBUMBNLPGLBML-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 8-methoxy-9-methylfuro[2,3-b]quinolin-4-one |
| InChIKey | VNBUMBNLPGLBML-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2OC)C(=O)C3=C1OC=C3 |
Computed by PubChem (NCBI)