Products 569-59-5
CAS 569-59-5 is the registry number for Phenindamine (tartrate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-2,3-dihydroxybutanedioic acid;2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (CAS 569-59-5) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine. InChIKey: WFXURHIXPXVPGM-LREBCSMRSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| InChIKey | WFXURHIXPXVPGM-LREBCSMRSA-N |
| SMILES | CN1CCC2=C(C1)C(C3=CC=CC=C23)C4=CC=CC=C4.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)