Products 569-60-8
CAS 569-60-8 appears in our catalog under these names: 4-[(4-Hydroxyphenyl)phenylmethylene]-2,5-cyclohexadien-1-one, 95%+, 95%+, 4-[(4-hydroxyphenyl)-phenyl-methylidene]cyclohexa-2,5-dien-1-one, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-[(4-hydroxyphenyl)-phenylmethylidene]cyclohexa-2,5-dien-1-one (CAS 569-60-8) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)-phenylmethylidene]cyclohexa-2,5-dien-1-one. InChIKey: IWNZKMGBKBEPSO-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)-phenylmethylidene]cyclohexa-2,5-dien-1-one |
| InChIKey | IWNZKMGBKBEPSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C2C=CC(=O)C=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)