Products 56946-60-2
CAS 56946-60-2 appears in our catalog under these names: 3-(4-Nitrophenyl)propylamine hydrochloride, 95%, 3-(4-Nitrophenyl)propan-1-amine hydrochloride, 97%, 3–(4–Nitrophenyl)propan–1–amine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-(4-nitrophenyl)propan-1-amine;hydrochloride (CAS 56946-60-2) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 3-(4-nitrophenyl)propan-1-amine;hydrochloride. InChIKey: UDRCLKQVXAKMQL-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3-(4-nitrophenyl)propan-1-amine;hydrochloride |
| InChIKey | UDRCLKQVXAKMQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)