CAS 56961-25-2 appears in our catalog under these names: 4–Amino–3,5–dichlorobenzoic acid, 4-Amino-3,5-dichlorobenzoic acid, 98% , 4-Amino-3,5-dichlorobenzoic acid, 4-Amino-3,5-dichlorobenzoic acid 97%, 4-Amino-3,5-dichlorobenzoic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 0,25kg, 0,1kg, 1g, 500g, 10g.
4-amino-3,5-dichlorobenzoic acid (CAS 56961-25-2) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4-amino-3,5-dichlorobenzoic acid. InChIKey: UHXYYTSWBYTDPD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 4-amino-3,5-dichlorobenzoic acid |
| InChIKey | UHXYYTSWBYTDPD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C(=O)O |
Computed by PubChem (NCBI)