Products 56985-87-6
CAS 56985-87-6 appears in our catalog under these names: 4-Nitrophenyl 2-bromopropanoate, 95%, 4-Nitrophenyl 2-bromopropanoate, 4-Nitrophenyl 2-bromopropanoate 91%, 4-nitrophenyl 2-bromopropanoate, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(4-nitrophenyl) 2-bromopropanoate (CAS 56985-87-6) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: (4-nitrophenyl) 2-bromopropanoate. InChIKey: LOVOFTZGZYJDIM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | (4-nitrophenyl) 2-bromopropanoate |
| InChIKey | LOVOFTZGZYJDIM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)