CAS 57182-48-6 is the registry number for Phentolamine Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(4-methylanilino)cyclohexa-2,5-diene-1,4-dione (CAS 57182-48-6) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-(4-methylanilino)cyclohexa-2,5-diene-1,4-dione. InChIKey: AXHABQXADKLDMB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-(4-methylanilino)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | AXHABQXADKLDMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)