CAS 5730-78-9 appears in our catalog under these names: 4–(4–AMinophenyl)benzoicacid, 4'-Amino-[1,1'-biphenyl]-4-carboxylic acid, 95%, 95%, 4'-Amino-biphenyl-4-carboxylic acid, 95%, 4'-Amino-[1,1'-biphenyl]-4-carboxylic acid, 95%, 4'-Amino-[1,1'-biphenyl]-4-carboxylic acid 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g.
4-(4-aminophenyl)benzoic acid (CAS 5730-78-9) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 4-(4-aminophenyl)benzoic acid. InChIKey: ZSFKODANZQVHCK-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 4-(4-aminophenyl)benzoic acid |
| InChIKey | ZSFKODANZQVHCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)