CAS 573675-39-5 is the registry number for 5-Bromo-3-hydroxyisoindolin-1-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-3-hydroxy-2,3-dihydroisoindol-1-one (CAS 573675-39-5) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-3-hydroxy-2,3-dihydroisoindol-1-one. InChIKey: TVBQCEKYWVTSSG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-3-hydroxy-2,3-dihydroisoindol-1-one |
| InChIKey | TVBQCEKYWVTSSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(NC2=O)O |
Computed by PubChem (NCBI)