Products 57459-36-6
CAS 57459-36-6 is the registry number for 2-(3-Phenyl-1,2,4-oxadiazol-5-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(3-phenyl-1,2,4-oxadiazol-5-yl)acetonitrile (CAS 57459-36-6) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 2-(3-phenyl-1,2,4-oxadiazol-5-yl)acetonitrile. InChIKey: SDGOZZSULWVMFC-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)acetonitrile |
| InChIKey | SDGOZZSULWVMFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CC#N |
Computed by PubChem (NCBI)