CAS 5762-27-6 appears in our catalog under these names: 1-Oxo-isochroman-3-carboxylic acid, 95%, 1-Oxoisochroman-3-carboxylic acid, 97%, 1-Oxo-isochroman-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 50mg, 0,5g.
1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CAS 5762-27-6) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 1-oxo-3,4-dihydroisochromene-3-carboxylic acid. InChIKey: AMDCSPFANXXWQC-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| InChIKey | AMDCSPFANXXWQC-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)