CAS 57697-76-4 is the registry number for 2-Phenylfuran-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-phenylfuran-3-carboxylic acid (CAS 57697-76-4) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2-phenylfuran-3-carboxylic acid. InChIKey: JFLHLECAMDNXRC-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-phenylfuran-3-carboxylic acid |
| InChIKey | JFLHLECAMDNXRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CO2)C(=O)O |
Computed by PubChem (NCBI)