CAS 57764-48-4 is the registry number for hydroxyimino–(2–nitro–phenyl)–acetic acid ethyl ester. Offered by: GLPBio. Available pack sizes: 200mg.
Ethyl 2-hydroxyimino-2-(2-nitrophenyl)acetate (CAS 57764-48-4) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: ethyl 2-hydroxyimino-2-(2-nitrophenyl)acetate. InChIKey: RLNHFZRONMGHIH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | ethyl 2-hydroxyimino-2-(2-nitrophenyl)acetate |
| InChIKey | RLNHFZRONMGHIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=NO)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)