CAS 57817-03-5 appears in our catalog under these names: 6-Fluoro-7-methylindoline-2,3-dione, 95%, 6-Fluoro-7-Methylisatin, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
6-fluoro-7-methyl-1H-indole-2,3-dione (CAS 57817-03-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-7-methyl-1H-indole-2,3-dione. InChIKey: SCTZCVLCXNUKGW-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-7-methyl-1H-indole-2,3-dione |
| InChIKey | SCTZCVLCXNUKGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2=O)F |
Computed by PubChem (NCBI)