Products 5783-36-8
CAS 5783-36-8 appears in our catalog under these names: 4-(3-Methoxyphenyl)benzoic acid, 98%, 4-(3-Methoxyphenyl)benzoic acid, 97%, 3'-Methoxy-[1,1'-biphenyl]-4-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 25g, 5g, 1g, 250mg, 500mg, 10g, 100g.
4-(3-methoxyphenyl)benzoic acid (CAS 5783-36-8) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 4-(3-methoxyphenyl)benzoic acid. InChIKey: OAMJQKDGQYAQKD-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)benzoic acid |
| InChIKey | OAMJQKDGQYAQKD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(3-methoxyphenyl)benzoic Acid, 3'-methoxy-[1,1'-biphenyl]-4-carboxylic acid, 3'-Methoxy-biphenyl-4-carboxylic acid, 3'-methoxy-4-biphenylcarboxylic acid, 3'-methoxy[1,1'-biphenyl]-4-carboxylic acid, 4-biphenyl-(3'-methoxy)carboxylic acid, [1,1'-Biphenyl]-4-carboxylic acid, 3'-methoxy-, 3'-methoxybiphenyl-4-carboxylic acid, 3'-methoxy-1,1'-biphenyl-4-carboxylic acid, 4-(3'-methoxyphenyl)benzoic acid