CAS 58110-34-2 is the registry number for (E)–3–(5–(4–Nitrophenyl)furan–2–yl)acrylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(E)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoic acid (CAS 58110-34-2) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: (E)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoic acid. InChIKey: OGFLVOQOCHNPDE-SOFGYWHQSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | (E)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enoic acid |
| InChIKey | OGFLVOQOCHNPDE-SOFGYWHQSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)