Products 58230-12-9
CAS 58230-12-9 appears in our catalog under these names: 4-Oxocyclohexane-1,1-dicarboxylic acid, 97%, 97%, 4-OXOCYCLOHEXANE-1,1-DICARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-oxocyclohexane-1,1-dicarboxylic acid (CAS 58230-12-9) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 4-oxocyclohexane-1,1-dicarboxylic acid. InChIKey: NHOAIPRHGSAFDL-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 4-oxocyclohexane-1,1-dicarboxylic acid |
| InChIKey | NHOAIPRHGSAFDL-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)