CAS 58332-00-6 is the registry number for Methyl 2-cyano-5-iodobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg.
Methyl 2-cyano-5-iodobenzoate (CAS 58332-00-6) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: methyl 2-cyano-5-iodobenzoate. InChIKey: FTMUDTOUHNUCRP-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | methyl 2-cyano-5-iodobenzoate |
| InChIKey | FTMUDTOUHNUCRP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)I)C#N |
Computed by PubChem (NCBI)