CAS 5840-66-4 is the registry number for 4-Benzyloxyphthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenylmethoxyphthalic acid (CAS 5840-66-4) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 4-phenylmethoxyphthalic acid. InChIKey: OMUYYSOSMCNPJR-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 4-phenylmethoxyphthalic acid |
| InChIKey | OMUYYSOSMCNPJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)