Products 58472-26-7
CAS 58472-26-7 appears in our catalog under these names: 2-Hydroxy-7-methylnaphthalene-1,4-dione, ≥95%, 2-Hydroxy-7-methyl-1,4-naphthalenedione, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-hydroxy-7-methylnaphthalene-1,2-dione (CAS 58472-26-7) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 4-hydroxy-7-methylnaphthalene-1,2-dione. InChIKey: MLIQHPFZCIMTHD-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-hydroxy-7-methylnaphthalene-1,2-dione |
| InChIKey | MLIQHPFZCIMTHD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=O)C2=O)O |
Computed by PubChem (NCBI)