CAS 58535-38-9 appears in our catalog under these names: Amlodipine Impurity 48, Amlodipine Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dihydro-3H-2,5-benzoxazocine-1,6-dione (CAS 58535-38-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4,5-dihydro-3H-2,5-benzoxazocine-1,6-dione. InChIKey: NZCGEOUOFYNGIY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4,5-dihydro-3H-2,5-benzoxazocine-1,6-dione |
| InChIKey | NZCGEOUOFYNGIY-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)