CAS 58865-02-4 appears in our catalog under these names: (R)-7-Hydroxy-3-(4-hydroxyphenyl)chroman-4-one 98% 99%ee, (R)–2,3–Dihydro–7–hydroxy–3–(4–hydroxyphenyl)–4H–1–benzopyran–4–one, (R)-7-Hydroxy-3-(4-hydroxyphenyl)chroman-4-one, 98% 99%ee, 98% 99%ee. Offered by: Ambeed, GLPBio, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(3R)-7-hydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (CAS 58865-02-4) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: (3R)-7-hydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: JHYXBPPMXZIHKG-ZDUSSCGKSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (3R)-7-hydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | JHYXBPPMXZIHKG-ZDUSSCGKSA-N |
| SMILES | C1[C@H](C(=O)C2=C(O1)C=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)