Products 59225-86-4
CAS 59225-86-4 is the registry number for 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione (CAS 59225-86-4) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione. InChIKey: TWDXOJOBVIGEOK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione |
| InChIKey | TWDXOJOBVIGEOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=O)NC(=C2)C |
Computed by PubChem (NCBI)