CAS 59265-81-5 is the registry number for isopropyl 4-amino-2-chlorobenzoate. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 4-amino-2-chlorobenzoate (CAS 59265-81-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propan-2-yl 4-amino-2-chlorobenzoate. InChIKey: BMIVTCLLDDCNOU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propan-2-yl 4-amino-2-chlorobenzoate |
| InChIKey | BMIVTCLLDDCNOU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)