Products 5945-42-6
CAS 5945-42-6 is the registry number for Aromaticin, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg.
Aromaticin is a sesquiterpene lactone that is 3,3a,4,4a,7a,8,9,9a-octahydroazuleno[6,5-b]furan-2,5-dione substituted by methyl groups at positions 4a and 8 and a methylidene group at position 3. Isolated from the aerial parts of Inula hupehensis, it exhibits anti-inflammatory activity. It has a role as a metabolite, an anti-inflammatory agent and a plant metabolite. It is an organic heterotricyclic compound, a gamma-lactone, a sesquiterpene lactone and a cyclic ketone.
Source: ChEBI
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (3aS,5R,5aR,8aS,9aR)-5,8a-dimethyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione |
| InChIKey | OSSDUQKWVVZIGP-SCGWIAOYSA-N |
| SMILES | C[C@@H]1C[C@H]2[C@H](C[C@]3([C@H]1C=CC3=O)C)C(=C)C(=O)O2 |
Computed by PubChem (NCBI)
Synonyms:
Aromaticin, cid_282529