CAS 85622-69-1 appears in our catalog under these names: 2-(4-Methoxybenzenesulfonamido)propanoic acid, 2-(4-Methoxybenzenesulfonamido)propanoic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 5mg, 25mg, 100mg.
2-[(4-methoxyphenyl)sulfonylamino]propanoic acid (CAS 85622-69-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid. InChIKey: XTCIPBHRVYICGT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| InChIKey | XTCIPBHRVYICGT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)