CAS 59843-77-5 appears in our catalog under these names: 3–(3–Nitrophenyl)pyrazole, 3-(3-Nitrophenyl)-1H-pyrazole 96%, 3-(3-Nitrophenyl)pyrazole, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
5-(3-nitrophenyl)-1H-pyrazole (CAS 59843-77-5) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 5-(3-nitrophenyl)-1H-pyrazole. InChIKey: RUWXJVIBNZSEQD-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1H-pyrazole |
| InChIKey | RUWXJVIBNZSEQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC=NN2 |
Computed by PubChem (NCBI)