CAS 59899-13-7 appears in our catalog under these names: 2-(5-Aminoisoxazol-3-yl)phenol, 95%, 2–(5–Aminoisoxazol–3–yl)phenol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(5-amino-1,2-oxazol-3-yl)phenol (CAS 59899-13-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(5-amino-1,2-oxazol-3-yl)phenol. InChIKey: GBKYOYOKBWCLMJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(5-amino-1,2-oxazol-3-yl)phenol |
| InChIKey | GBKYOYOKBWCLMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)N)O |
Computed by PubChem (NCBI)