Products 5991-56-0
CAS 5991-56-0 appears in our catalog under these names: 8-Methoxynaphthalene-1-carboxylic acid, 8-Methoxy-1-naphthoic acid 97%, 8-Methoxy-1-naphthoic acid, 97%, 97%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
8-methoxynaphthalene-1-carboxylic acid (CAS 5991-56-0) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 8-methoxynaphthalene-1-carboxylic acid. InChIKey: AGWGITMRMDHPGN-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 8-methoxynaphthalene-1-carboxylic acid |
| InChIKey | AGWGITMRMDHPGN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)