Products 59967-83-8
CAS 59967-83-8 is the registry number for Cyclopentyluracil. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione (CAS 59967-83-8) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione. InChIKey: XCUVKEVNSATDTD-GCXDCGAKSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| InChIKey | XCUVKEVNSATDTD-GCXDCGAKSA-N |
| SMILES | C1[C@@H]([C@H]([C@H]([C@@H]1N2C=CC(=O)NC2=O)O)O)CO |
Computed by PubChem (NCBI)