Products 60115-66-4

CAS 60115-66-4 is the registry number for Carbocisteine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-3-(2-ethoxy-2-oxoethyl)sulfanylpropanoic acid (CAS 60115-66-4) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 2-amino-3-(2-ethoxy-2-oxoethyl)sulfanylpropanoic acid. InChIKey: VIXQGZPMIWPLTK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name2-amino-3-(2-ethoxy-2-oxoethyl)sulfanylpropanoic acid
InChIKeyVIXQGZPMIWPLTK-UHFFFAOYSA-N
SMILESCCOC(=O)CSCC(C(=O)O)N

Computed by PubChem (NCBI)