Products 6025-56-5
CAS 6025-56-5 appears in our catalog under these names: 3-(Phenylamino)benzoic acid, 95-<97%, 3-(Phenylamino)benzoic acid, ≥97-<99%, 3-(Phenylamino)benzoic acid, 97%, 3-(Phenylamino)benzoic acid, 3-(Phenylamino)benzoic acid, 98%, 98%. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 0,5g, 50mg, 100mg.
3-anilinobenzoic acid (CAS 6025-56-5) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 3-anilinobenzoic acid. InChIKey: RCHSJRJPIWLNPN-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 3-anilinobenzoic acid |
| InChIKey | RCHSJRJPIWLNPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)