Products 60352-12-7
CAS 60352-12-7 is the registry number for Siamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,8-dihydroxy-3-methyl-2H-isoquinolin-1-one (CAS 60352-12-7) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6,8-dihydroxy-3-methyl-2H-isoquinolin-1-one. InChIKey: RDYSDCWZHHUGIB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6,8-dihydroxy-3-methyl-2H-isoquinolin-1-one |
| InChIKey | RDYSDCWZHHUGIB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=CC(=C2C(=O)N1)O)O |
Computed by PubChem (NCBI)