CAS 605-60-7 appears in our catalog under these names: 4-Nitrosonaphthalen-1-ol, 95%, 4-Nitrosonaphthalen-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-nitrosonaphthalen-1-ol (CAS 605-60-7) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 4-nitrosonaphthalen-1-ol. InChIKey: ZVNOVIBCAIDQOE-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-nitrosonaphthalen-1-ol |
| InChIKey | ZVNOVIBCAIDQOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)N=O |
Computed by PubChem (NCBI)