CAS 60538-16-1 appears in our catalog under these names: Z–D–Thr–OMe, Bz-D-Thr-OMe. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 2g, 5g, 10g, 25g.
Methyl (2R,3S)-2-benzamido-3-hydroxybutanoate (CAS 60538-16-1) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: methyl (2R,3S)-2-benzamido-3-hydroxybutanoate. InChIKey: KHOWDUMYRBCHAC-WCBMZHEXSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl (2R,3S)-2-benzamido-3-hydroxybutanoate |
| InChIKey | KHOWDUMYRBCHAC-WCBMZHEXSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC)NC(=O)C1=CC=CC=C1)O |
Computed by PubChem (NCBI)