CAS 60584-76-1 appears in our catalog under these names: 2-(((Benzyloxy)carbonyl)amino)-2-phenylacetic acid, Cbz-DL-Phg-OH 95%, 2-(((Benzyloxy)carbonyl)amino)-2-phenylacetic acid, 95%, 95%, {[(Benzyloxy)carbonyl]amino}(phenyl)acetic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 2,5g, 5g, 100g.
2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid (CAS 60584-76-1) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: RLDJWBVOZVJJOS-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | RLDJWBVOZVJJOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)