Products 606-84-8
CAS 606-84-8 appears in our catalog under these names: 3,3-Diphenylacrylic acid 95%, 3,3-Diphenylacrylic acid, 95%, 95%, 3,3-Diphenylacrylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,3-diphenylprop-2-enoic acid (CAS 606-84-8) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 3,3-diphenylprop-2-enoic acid. InChIKey: WMJBVALTYVXGHW-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 3,3-diphenylprop-2-enoic acid |
| InChIKey | WMJBVALTYVXGHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3,3-Diphenylacrylic acid, 3,3-Diphenyl-2-propenoic acid, 4-09-00-02616 (Beilstein Handbook Reference), WMJBVALTYVXGHW-UHFFFAOYSA-N, 3,3-diphenylprop-2-enoic acid, 2-Propenoic acid, 3,3-diphenyl-, beta-Phenylcinnamic acid, Acido difenililacrilico, Acido difenililacrilico [Italian], 3,3-Diphenylpropenoic acid