Products 606080-43-7
CAS 606080-43-7 appears in our catalog under these names: Methyl 2–cyano–5–fluorobenzoate, Methyl 2-cyano-5-fluorobenzoate, Methyl 2-cyano-5-fluorobenzoate 97%, Methyl 2-cyano-5-fluorobenzoate, 97%, 97%, METHYL 2-CYANO-5-FLUOROBENZOATE, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 2,5g, 500g, 25g, 100g, 50g, 250mg.
Methyl 2-cyano-5-fluorobenzoate (CAS 606080-43-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: methyl 2-cyano-5-fluorobenzoate. InChIKey: CVFHFKWDNDKBOV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | methyl 2-cyano-5-fluorobenzoate |
| InChIKey | CVFHFKWDNDKBOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)F)C#N |
Computed by PubChem (NCBI)