Products 60901-21-5
CAS 60901-21-5 is the registry number for Benzoic acid, 2-(2-phenylethenyl)-, 97%. Offered by: Chemat. Available pack sizes: 1g.
2-[(E)-2-phenylethenyl]benzoic acid (CAS 60901-21-5) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]benzoic acid. InChIKey: MGJDPQKVELOHMT-ZHACJKMWSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]benzoic acid |
| InChIKey | MGJDPQKVELOHMT-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Styrylbenzoic acid, 2-Stilbenecarboxylic acid, (E)-, 2-[(E)-2-Phenylethenyl]benzoic acid, (E)-2-Styrylbenzoic acid, Stilbene-2-carboxylic acid, trans-2-Stilbenecarboxylic acid, 2-Stilbenecarboxylic acid, trans-, Benzoic acid, 2-(2-phenylethenyl)-, (E)-2-(2-Phenylethenyl)benzoic acid, Benzoic acid, 2-((1E)-2-phenylethenyl)-